C20H22F3N3O3 — CID 154852674
1-[1-[2-cyclopropyl-6-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]piperidine-2,6-dione (PubChem CID 154852674) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is 1-[1-[2-cyclopropyl-6-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]piperidine-2,6-dione.
| Compound Name | 1-[1-[2-cyclopropyl-6-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154852674 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-[1-[2-cyclopropyl-6-(trifluoromethyl)pyridine-4-carbonyl]piperidin-4-yl]piperidine-2,6-dione |
| SMILES | O=C(c1cc(C2CC2)nc(C(F)(F)F)c1)N1CCC(N2C(=O)CCCC2=O)CC1 |
| InChI | InChI=1S/C20H22F3N3O3/c21-20(22,23)16-11-13(10-15(24-16)12-4-5-12)19(29)25-8-6-14(7-9-25)26-17(27)2-1-3-18(26)28/h10-12,14H,1-9H2 |
| InChIKey | OQTWLUBJAZCCRB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|