C14H15BrN4OS — CID 154853325
2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-(1H-indol-3-yl)ethanone bromide (PubChem CID 154853325) has the molecular formula C14H15BrN4OS and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-(1H-indol-3-yl)ethanone bromide.
| Compound Name | 2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-(1H-indol-3-yl)ethanone bromide |
|---|---|
| PubChem CID | 154853325 |
| Molecular Formula | C14H15BrN4OS |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2-(2-amino-5-ethyl-1,3,4-thiadiazol-3-ium-3-yl)-1-(1H-indol-3-yl)ethanone bromide |
| SMILES | CCc1n[n+](CC(=O)c2c[nH]c3ccccc23)c(N)s1.[Br-] |
| InChI | InChI=1S/C14H14N4OS.BrH/c1-2-13-17-18(14(15)20-13)8-12(19)10-7-16-11-6-4-3-5-9(10)11;/h3-7,15H,2,8H2,1H3,(H,16,19);1H |
| InChIKey | JDSWSYYNNBRMPD-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|