C19H20FN5O5S — CID 154854082
1-[4-[4-(5-fluoro-4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione (PubChem CID 154854082) has the molecular formula C19H20FN5O5S and a molecular weight of 449.46 g/mol. Its IUPAC name is 1-[4-[4-(5-fluoro-4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-(5-fluoro-4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 154854082 |
| Molecular Formula | C19H20FN5O5S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 1-[4-[4-(5-fluoro-4-methyl-6-oxo-1H-pyrimidin-2-yl)piperazin-1-yl]sulfonylphenyl]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(N2CCN(S(=O)(=O)c3ccc(N4C(=O)CCC4=O)cc3)CC2)[nH]c(=O)c1F |
| InChI | InChI=1S/C19H20FN5O5S/c1-12-17(20)18(28)22-19(21-12)23-8-10-24(11-9-23)31(29,30)14-4-2-13(3-5-14)25-15(26)6-7-16(25)27/h2-5H,6-11H2,1H3,(H,21,22,28) |
| InChIKey | IROPMLFGOUAAOI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|