C17H17BrN4O — CID 154863864
6-[[4-(3-bromophenyl)oxan-4-yl]methylamino]pyrimidine-4-carbonitrile (PubChem CID 154863864) has the molecular formula C17H17BrN4O and a molecular weight of 373.25 g/mol. Its IUPAC name is 6-[[4-(3-bromophenyl)oxan-4-yl]methylamino]pyrimidine-4-carbonitrile.
| Compound Name | 6-[[4-(3-bromophenyl)oxan-4-yl]methylamino]pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 154863864 |
| Molecular Formula | C17H17BrN4O |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 6-[[4-(3-bromophenyl)oxan-4-yl]methylamino]pyrimidine-4-carbonitrile |
| SMILES | N#Cc1cc(NCC2(c3cccc(Br)c3)CCOCC2)ncn1 |
| InChI | InChI=1S/C17H17BrN4O/c18-14-3-1-2-13(8-14)17(4-6-23-7-5-17)11-20-16-9-15(10-19)21-12-22-16/h1-3,8-9,12H,4-7,11H2,(H,20,21,22) |
| InChIKey | GHKZLVZSZWBKNM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |