C18H19N3O4S — CID 154864345
N-cyclobutylsulfonyl-4-(phenylcarbamoylamino)benzamide (PubChem CID 154864345) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-cyclobutylsulfonyl-4-(phenylcarbamoylamino)benzamide.
| Compound Name | N-cyclobutylsulfonyl-4-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 154864345 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-cyclobutylsulfonyl-4-(phenylcarbamoylamino)benzamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(C(=O)NS(=O)(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C18H19N3O4S/c22-17(21-26(24,25)16-7-4-8-16)13-9-11-15(12-10-13)20-18(23)19-14-5-2-1-3-6-14/h1-3,5-6,9-12,16H,4,7-8H2,(H,21,22)(H2,19,20,23) |
| InChIKey | CNUAZKMZFXXDKX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |