C18H22N2O3S — CID 174727310
cyclopentanesulfonamide;N-phenylbenzamide (PubChem CID 174727310) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is cyclopentanesulfonamide;N-phenylbenzamide.
| Compound Name | cyclopentanesulfonamide;N-phenylbenzamide |
|---|---|
| PubChem CID | 174727310 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | cyclopentanesulfonamide;N-phenylbenzamide |
| SMILES | NS(=O)(=O)C1CCCC1.O=C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H11NO.C5H11NO2S/c15-13(11-7-3-1-4-8-11)14-12-9-5-2-6-10-12;6-9(7,8)5-3-1-2-4-5/h1-10H,(H,14,15);5H,1-4H2,(H2,6,7,8) |
| InChIKey | HYWKYDUOZSIQDB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |