C23H32N4O4 — CID 154864361
4-tert-butyl-N-[1-(2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 154864361) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-(2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 154864361 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 4-tert-butyl-N-[1-(2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)N1CCCC2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C23H32N4O4/c1-14(2)17(24-18(28)15-7-9-16(10-8-15)22(3,4)5)19(29)27-12-6-11-23(13-27)20(30)25-21(31)26-23/h7-10,14,17H,6,11-13H2,1-5H3,(H,24,28)(H2,25,26,30,31) |
| InChIKey | RTDZOQUUUOLCFP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|