C19H21N5O4 — CID 154864812
methyl 2-[[(Z)-[amino-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methylidene]amino]oxymethyl]-1,3-oxazole-4-carboxylate (PubChem CID 154864812) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is methyl 2-[[(Z)-[amino-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methylidene]amino]oxymethyl]-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-[[(Z)-[amino-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methylidene]amino]oxymethyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 154864812 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | methyl 2-[[(Z)-[amino-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]methylidene]amino]oxymethyl]-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)c1coc(CO/N=C(\N)c2cccc(Cn3nc(C)cc3C)c2)n1 |
| InChI | InChI=1S/C19H21N5O4/c1-12-7-13(2)24(22-12)9-14-5-4-6-15(8-14)18(20)23-28-11-17-21-16(10-27-17)19(25)26-3/h4-8,10H,9,11H2,1-3H3,(H2,20,23) |
| InChIKey | HNNTWJPSRMHMIM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|