C24H25N5O2 — CID 126805497
3-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methoxy]benzenecarboximidamide (PubChem CID 126805497) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methoxy]benzenecarboximidamide.
| Compound Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 126805497 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-[(3,5-dimethylpyrazol-1-yl)methyl]-N'-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methoxy]benzenecarboximidamide |
| SMILES | Cc1ccc(-c2cnc(CON=C(N)c3cccc(Cn4nc(C)cc4C)c3)o2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-16-7-9-20(10-8-16)22-13-26-23(31-22)15-30-28-24(25)21-6-4-5-19(12-21)14-29-18(3)11-17(2)27-29/h4-13H,14-15H2,1-3H3,(H2,25,28) |
| InChIKey | WFMNZMRYQJBGDK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|