C16H17F3N2O4 — CID 154866910
[(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2-methoxy-3-nitrophenyl)methanone (PubChem CID 154866910) has the molecular formula C16H17F3N2O4 and a molecular weight of 358.32 g/mol. Its IUPAC name is [(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2-methoxy-3-nitrophenyl)methanone.
| Compound Name | [(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2-methoxy-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 154866910 |
| Molecular Formula | C16H17F3N2O4 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [(3aR,6aR)-3a-(trifluoromethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-(2-methoxy-3-nitrophenyl)methanone |
| SMILES | COc1c(C(=O)N2C[C@@H]3CCC[C@]3(C(F)(F)F)C2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17F3N2O4/c1-25-13-11(5-2-6-12(13)21(23)24)14(22)20-8-10-4-3-7-15(10,9-20)16(17,18)19/h2,5-6,10H,3-4,7-9H2,1H3/t10-,15-/m0/s1 |
| InChIKey | AGRZUPXOVSZYLK-BONVTDFDSA-N |
| XLogP | 3.41 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|