C21H24N2O3 — CID 154867335
1-[(3aR)-1,2,3,3a,4,6-hexahydropyrrolo[1,2-a][1,4]benzodiazepin-5-yl]-2-[4-(hydroxymethyl)phenoxy]ethanone (PubChem CID 154867335) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[(3aR)-1,2,3,3a,4,6-hexahydropyrrolo[1,2-a][1,4]benzodiazepin-5-yl]-2-[4-(hydroxymethyl)phenoxy]ethanone.
| Compound Name | 1-[(3aR)-1,2,3,3a,4,6-hexahydropyrrolo[1,2-a][1,4]benzodiazepin-5-yl]-2-[4-(hydroxymethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 154867335 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-[(3aR)-1,2,3,3a,4,6-hexahydropyrrolo[1,2-a][1,4]benzodiazepin-5-yl]-2-[4-(hydroxymethyl)phenoxy]ethanone |
| SMILES | O=C(COc1ccc(CO)cc1)N1Cc2ccccc2N2CCC[C@@H]2C1 |
| InChI | InChI=1S/C21H24N2O3/c24-14-16-7-9-19(10-8-16)26-15-21(25)22-12-17-4-1-2-6-20(17)23-11-3-5-18(23)13-22/h1-2,4,6-10,18,24H,3,5,11-15H2/t18-/m1/s1 |
| InChIKey | TUMZXLATIJXNGF-GOSISDBHSA-N |
| XLogP | 2.57 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |