C13H17NO4S2 — CID 154869025
(2R,3S)-N-(3-methylthiophen-2-yl)sulfonyl-2-prop-1-en-2-yloxolane-3-carboxamide (PubChem CID 154869025) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (2R,3S)-N-(3-methylthiophen-2-yl)sulfonyl-2-prop-1-en-2-yloxolane-3-carboxamide.
| Compound Name | (2R,3S)-N-(3-methylthiophen-2-yl)sulfonyl-2-prop-1-en-2-yloxolane-3-carboxamide |
|---|---|
| PubChem CID | 154869025 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | (2R,3S)-N-(3-methylthiophen-2-yl)sulfonyl-2-prop-1-en-2-yloxolane-3-carboxamide |
| SMILES | C=C(C)[C@@H]1OCC[C@@H]1C(=O)NS(=O)(=O)c1sccc1C |
| InChI | InChI=1S/C13H17NO4S2/c1-8(2)11-10(4-6-18-11)12(15)14-20(16,17)13-9(3)5-7-19-13/h5,7,10-11H,1,4,6H2,2-3H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | ZPIIVWXSNLKYFG-QWRGUYRKSA-N |
| XLogP | 1.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|