C10H13NO5S2 — CID 167780643
2-cyclopropyl-2-[(3-methylthiophen-2-yl)sulfonylamino]oxyacetic acid (PubChem CID 167780643) has the molecular formula C10H13NO5S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(3-methylthiophen-2-yl)sulfonylamino]oxyacetic acid.
| Compound Name | 2-cyclopropyl-2-[(3-methylthiophen-2-yl)sulfonylamino]oxyacetic acid |
|---|---|
| PubChem CID | 167780643 |
| Molecular Formula | C10H13NO5S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 2-cyclopropyl-2-[(3-methylthiophen-2-yl)sulfonylamino]oxyacetic acid |
| SMILES | Cc1ccsc1S(=O)(=O)NOC(C(=O)O)C1CC1 |
| InChI | InChI=1S/C10H13NO5S2/c1-6-4-5-17-10(6)18(14,15)11-16-8(9(12)13)7-2-3-7/h4-5,7-8,11H,2-3H2,1H3,(H,12,13) |
| InChIKey | KOITUKPRQFOHAI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|