C15H15NO4S2 — CID 166263601
2-[(3-cyclopropylthiophen-2-yl)sulfonylamino]-2-phenylacetic acid (PubChem CID 166263601) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(3-cyclopropylthiophen-2-yl)sulfonylamino]-2-phenylacetic acid.
| Compound Name | 2-[(3-cyclopropylthiophen-2-yl)sulfonylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 166263601 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-[(3-cyclopropylthiophen-2-yl)sulfonylamino]-2-phenylacetic acid |
| SMILES | O=C(O)C(NS(=O)(=O)c1sccc1C1CC1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO4S2/c17-14(18)13(11-4-2-1-3-5-11)16-22(19,20)15-12(8-9-21-15)10-6-7-10/h1-5,8-10,13,16H,6-7H2,(H,17,18) |
| InChIKey | SJQHBRUXQDLRGB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |