C13H12FNO2S2 — CID 166369522
3-cyclopropyl-N-(2-fluorophenyl)thiophene-2-sulfonamide (PubChem CID 166369522) has the molecular formula C13H12FNO2S2 and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-cyclopropyl-N-(2-fluorophenyl)thiophene-2-sulfonamide.
| Compound Name | 3-cyclopropyl-N-(2-fluorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166369522 |
| Molecular Formula | C13H12FNO2S2 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 3-cyclopropyl-N-(2-fluorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1F)c1sccc1C1CC1 |
| InChI | InChI=1S/C13H12FNO2S2/c14-11-3-1-2-4-12(11)15-19(16,17)13-10(7-8-18-13)9-5-6-9/h1-4,7-9,15H,5-6H2 |
| InChIKey | LGCLZPBYERLCTJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |