C14H16N2O4S3 — CID 166265972
3-cyclopropyl-N-[2-(methanesulfonamido)phenyl]thiophene-2-sulfonamide (PubChem CID 166265972) has the molecular formula C14H16N2O4S3 and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-(methanesulfonamido)phenyl]thiophene-2-sulfonamide.
| Compound Name | 3-cyclopropyl-N-[2-(methanesulfonamido)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166265972 |
| Molecular Formula | C14H16N2O4S3 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 3-cyclopropyl-N-[2-(methanesulfonamido)phenyl]thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1NS(=O)(=O)c1sccc1C1CC1 |
| InChI | InChI=1S/C14H16N2O4S3/c1-22(17,18)15-12-4-2-3-5-13(12)16-23(19,20)14-11(8-9-21-14)10-6-7-10/h2-5,8-10,15-16H,6-7H2,1H3 |
| InChIKey | ZTQCXZWWIZZPQF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |