C13H12F4N4O — CID 154870694
2,2,3,3-tetrafluoro-N-[(1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide (PubChem CID 154870694) has the molecular formula C13H12F4N4O and a molecular weight of 316.26 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 154870694 |
| Molecular Formula | C13H12F4N4O |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(1R)-2-phenyl-1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
| SMILES | O=C(N[C@H](Cc1ccccc1)c1ncn[nH]1)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H12F4N4O/c14-11(15)13(16,17)12(22)20-9(10-18-7-19-21-10)6-8-4-2-1-3-5-8/h1-5,7,9,11H,6H2,(H,20,22)(H,18,19,21)/t9-/m1/s1 |
| InChIKey | CVIGGQYNDUJGDP-SECBINFHSA-N |
| XLogP | 2.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|