C15H14F2N4O3 — CID 154870884
N-[(3R)-1-(2,4-dioxo-1H-pyrimidin-6-yl)pyrrolidin-3-yl]-3,4-difluorobenzamide (PubChem CID 154870884) has the molecular formula C15H14F2N4O3 and a molecular weight of 336.30 g/mol. Its IUPAC name is N-[(3R)-1-(2,4-dioxo-1H-pyrimidin-6-yl)pyrrolidin-3-yl]-3,4-difluorobenzamide.
| Compound Name | N-[(3R)-1-(2,4-dioxo-1H-pyrimidin-6-yl)pyrrolidin-3-yl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 154870884 |
| Molecular Formula | C15H14F2N4O3 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-[(3R)-1-(2,4-dioxo-1H-pyrimidin-6-yl)pyrrolidin-3-yl]-3,4-difluorobenzamide |
| SMILES | O=C(N[C@@H]1CCN(c2cc(=O)[nH]c(=O)[nH]2)C1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H14F2N4O3/c16-10-2-1-8(5-11(10)17)14(23)18-9-3-4-21(7-9)12-6-13(22)20-15(24)19-12/h1-2,5-6,9H,3-4,7H2,(H,18,23)(H2,19,20,22,24)/t9-/m1/s1 |
| InChIKey | CEFAUIJESBKTKZ-SECBINFHSA-N |
| XLogP | 0.35 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |