C19H15F2N3O2 — CID 98178982
2-[(3S)-3-[(3,4-difluorobenzoyl)amino]pyrrolidin-1-yl]benzoyl cyanide (PubChem CID 98178982) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is 2-[(3S)-3-[(3,4-difluorobenzoyl)amino]pyrrolidin-1-yl]benzoyl cyanide.
| Compound Name | 2-[(3S)-3-[(3,4-difluorobenzoyl)amino]pyrrolidin-1-yl]benzoyl cyanide |
|---|---|
| PubChem CID | 98178982 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[(3S)-3-[(3,4-difluorobenzoyl)amino]pyrrolidin-1-yl]benzoyl cyanide |
| SMILES | N#CC(=O)c1ccccc1N1CC[C@H](NC(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C19H15F2N3O2/c20-15-6-5-12(9-16(15)21)19(26)23-13-7-8-24(11-13)17-4-2-1-3-14(17)18(25)10-22/h1-6,9,13H,7-8,11H2,(H,23,26)/t13-/m0/s1 |
| InChIKey | KUDFKMNUQJXDKN-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|