C12H16N6OS — CID 154871139
1-(1,3-thiazol-2-yl)-3-[4-(1H-1,2,4-triazol-5-yl)cyclohexyl]urea (PubChem CID 154871139) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-yl)-3-[4-(1H-1,2,4-triazol-5-yl)cyclohexyl]urea.
| Compound Name | 1-(1,3-thiazol-2-yl)-3-[4-(1H-1,2,4-triazol-5-yl)cyclohexyl]urea |
|---|---|
| PubChem CID | 154871139 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(1,3-thiazol-2-yl)-3-[4-(1H-1,2,4-triazol-5-yl)cyclohexyl]urea |
| SMILES | O=C(Nc1nccs1)NC1CCC(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C12H16N6OS/c19-11(17-12-13-5-6-20-12)16-9-3-1-8(2-4-9)10-14-7-15-18-10/h5-9H,1-4H2,(H,14,15,18)(H2,13,16,17,19) |
| InChIKey | LJIUUSNVYGPOHE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |