C20H28ClN3O3 — CID 154871382
N-[3-(2-aminoethyl)cyclopentyl]-2-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide (PubChem CID 154871382) has the molecular formula C20H28ClN3O3 and a molecular weight of 393.92 g/mol. Its IUPAC name is N-[3-(2-aminoethyl)cyclopentyl]-2-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[3-(2-aminoethyl)cyclopentyl]-2-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 154871382 |
| Molecular Formula | C20H28ClN3O3 |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[3-(2-aminoethyl)cyclopentyl]-2-[(3R,4S)-3-(4-chlorophenyl)-4-(hydroxymethyl)pyrrolidin-1-yl]-2-oxoacetamide |
| SMILES | NCCC1CCC(NC(=O)C(=O)N2C[C@@H](CO)[C@H](c3ccc(Cl)cc3)C2)C1 |
| InChI | InChI=1S/C20H28ClN3O3/c21-16-4-2-14(3-5-16)18-11-24(10-15(18)12-25)20(27)19(26)23-17-6-1-13(9-17)7-8-22/h2-5,13,15,17-18,25H,1,6-12,22H2,(H,23,26)/t13?,15-,17?,18-/m0/s1 |
| InChIKey | DOUYHGRVADPPOL-NAIXVUCJSA-N |
| XLogP | 1.51 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|