C16H22N2O6 — CID 154872226
2-[1-[3-(furan-2-carbonylamino)propanoyl]piperidin-4-yl]-2-methoxyacetic acid (PubChem CID 154872226) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[1-[3-(furan-2-carbonylamino)propanoyl]piperidin-4-yl]-2-methoxyacetic acid.
| Compound Name | 2-[1-[3-(furan-2-carbonylamino)propanoyl]piperidin-4-yl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 154872226 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[1-[3-(furan-2-carbonylamino)propanoyl]piperidin-4-yl]-2-methoxyacetic acid |
| SMILES | COC(C(=O)O)C1CCN(C(=O)CCNC(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C16H22N2O6/c1-23-14(16(21)22)11-5-8-18(9-6-11)13(19)4-7-17-15(20)12-3-2-10-24-12/h2-3,10-11,14H,4-9H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | LAKWXMWJKQYUAB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |