C25H29N5O2 — CID 154873668
3-(4-oxoquinazolin-3-yl)-N-[2-(4-piperidin-1-ylphenyl)ethyl]azetidine-1-carboxamide (PubChem CID 154873668) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-(4-oxoquinazolin-3-yl)-N-[2-(4-piperidin-1-ylphenyl)ethyl]azetidine-1-carboxamide.
| Compound Name | 3-(4-oxoquinazolin-3-yl)-N-[2-(4-piperidin-1-ylphenyl)ethyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 154873668 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 3-(4-oxoquinazolin-3-yl)-N-[2-(4-piperidin-1-ylphenyl)ethyl]azetidine-1-carboxamide |
| SMILES | O=C(NCCc1ccc(N2CCCCC2)cc1)N1CC(n2cnc3ccccc3c2=O)C1 |
| InChI | InChI=1S/C25H29N5O2/c31-24-22-6-2-3-7-23(22)27-18-30(24)21-16-29(17-21)25(32)26-13-12-19-8-10-20(11-9-19)28-14-4-1-5-15-28/h2-3,6-11,18,21H,1,4-5,12-17H2,(H,26,32) |
| InChIKey | DWSWEFYWXSLAMB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|