C27H45N3O4 — CID 15487436
(R)-2-[(S)-1-((S)-3-Methyl-1-phenylcarbamoyl-butylcarbamoyl)-undecylamino]-propionic acid (PubChem CID 15487436) has the molecular formula C27H45N3O4 and a molecular weight of 475.70 g/mol. Its IUPAC name is (2R)-2-[[(2S)-1-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-1-oxododecan-2-yl]amino]propanoic acid.
| Compound Name | (R)-2-[(S)-1-((S)-3-Methyl-1-phenylcarbamoyl-butylcarbamoyl)-undecylamino]-propionic acid |
|---|---|
| PubChem CID | 15487436 |
| Molecular Formula | C27H45N3O4 |
| Molecular Weight | 475.70 g/mol |
| Exact Mass | 475.34 |
| IUPAC Name | (2R)-2-[[(2S)-1-[[(2S)-1-anilino-4-methyl-1-oxopentan-2-yl]amino]-1-oxododecan-2-yl]amino]propanoic acid |
| SMILES | CCCCCCCCCC[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)NC1=CC=CC=C1)N[C@H](C)C(=O)O |
| InChI | InChI=1S/C27H45N3O4/c1-5-6-7-8-9-10-11-15-18-23(28-21(4)27(33)34)25(31)30-24(19-20(2)3)26(32)29-22-16-13-12-14-17-22/h12-14,16-17,20-21,23-24,28H,5-11,15,18-19H2,1-4H3,(H,29,32)(H,30,31)(H,33,34)/t21-,23+,24+/m1/s1 |
| InChIKey | KTYADSSNJMMACA-NHTMILBNSA-N |
| XLogP | 4.60 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | 590 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.70 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|