C22H23ClN4O3 — CID 154875057
N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]-2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetamide (PubChem CID 154875057) has the molecular formula C22H23ClN4O3 and a molecular weight of 426.90 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]-2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetamide.
| Compound Name | N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]-2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 154875057 |
| Molecular Formula | C22H23ClN4O3 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]-2-(4,6-dimethyl-2-oxopyrimidin-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NC(CNC(=O)CCl)c2ccc3ccccc3c2)c(=O)n1 |
| InChI | InChI=1S/C22H23ClN4O3/c1-14-9-15(2)27(22(30)25-14)13-21(29)26-19(12-24-20(28)11-23)18-8-7-16-5-3-4-6-17(16)10-18/h3-10,19H,11-13H2,1-2H3,(H,24,28)(H,26,29) |
| InChIKey | KZOHNYKGXVLHRH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|