C20H23ClN6O2 — CID 154875030
2-tert-butyl-N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]tetrazole-5-carboxamide (PubChem CID 154875030) has the molecular formula C20H23ClN6O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is 2-tert-butyl-N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]tetrazole-5-carboxamide.
| Compound Name | 2-tert-butyl-N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 154875030 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-tert-butyl-N-[2-[(2-chloroacetyl)amino]-1-naphthalen-2-ylethyl]tetrazole-5-carboxamide |
| SMILES | CC(C)(C)n1nnc(C(=O)NC(CNC(=O)CCl)c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C20H23ClN6O2/c1-20(2,3)27-25-18(24-26-27)19(29)23-16(12-22-17(28)11-21)15-9-8-13-6-4-5-7-14(13)10-15/h4-10,16H,11-12H2,1-3H3,(H,22,28)(H,23,29) |
| InChIKey | WSQAXUSFBXTSBB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|