C26H22N6O2 — CID 167935636
N-[1-naphthalen-2-yl-2-[[2-(triazol-1-yl)acetyl]amino]ethyl]isoquinoline-4-carboxamide (PubChem CID 167935636) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[1-naphthalen-2-yl-2-[[2-(triazol-1-yl)acetyl]amino]ethyl]isoquinoline-4-carboxamide.
| Compound Name | N-[1-naphthalen-2-yl-2-[[2-(triazol-1-yl)acetyl]amino]ethyl]isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 167935636 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-[1-naphthalen-2-yl-2-[[2-(triazol-1-yl)acetyl]amino]ethyl]isoquinoline-4-carboxamide |
| SMILES | O=C(Cn1ccnn1)NCC(NC(=O)c1cncc2ccccc12)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H22N6O2/c33-25(17-32-12-11-29-31-32)28-16-24(20-10-9-18-5-1-2-6-19(18)13-20)30-26(34)23-15-27-14-21-7-3-4-8-22(21)23/h1-15,24H,16-17H2,(H,28,33)(H,30,34) |
| InChIKey | LZLXJZVJMUUHEP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |