About N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide
N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide (PubChem CID 167938401) has the molecular formula C26H20N4O3
and a molecular weight of 436.47 g/mol. Its IUPAC name is N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide |
| PubChem CID | 167938401 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide |
| SMILES | O=C(NCC(NC(=O)c1cncc2ccccc12)c1ccc2ccccc2c1)c1cnco1 |
| InChI | InChI=1S/C26H20N4O3/c31-25(22-13-27-12-20-7-3-4-8-21(20)22)30-23(14-29-26(32)24-15-28-16-33-24)19-10-9-17-5-1-2-6-18(17)11-19/h1-13,15-16,23H,14H2,(H,29,32)(H,30,31) |
| InChIKey | AFUIOUPKXCWMAT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide?
The IUPAC name of N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide (CID 167938401) is N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide.
What is the SMILES notation for N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide?
The canonical SMILES for N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide is O=C(NCC(NC(=O)c1cncc2ccccc12)c1ccc2ccccc2c1)c1cnco1.
What is the InChIKey of N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide?
The InChIKey is AFUIOUPKXCWMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N4O3/c31-25(22-13-27-12-20-7-3-4-8-21(20)22)30-23(14-29-26(32)24-15-28-16-33-24)19-10-9-17-5-1-2-6-18(17)11-19/h1-13,15-16,23H,14H2,(H,29,32)(H,30,31).
What are the key properties of N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide?
N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide has a molecular weight of 436.47 g/mol, XLogP of 4.28, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(isoquinoline-4-carbonylamino)-2-naphthalen-2-ylethyl]-1,3-oxazole-5-carboxamide is sourced from PubChem (CID 167938401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).