C21H21N3O3 — CID 154875331
2-ethyl-N-[1-naphthalen-2-yl-2-(prop-2-enoylamino)ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 154875331) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-ethyl-N-[1-naphthalen-2-yl-2-(prop-2-enoylamino)ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-ethyl-N-[1-naphthalen-2-yl-2-(prop-2-enoylamino)ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 154875331 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-ethyl-N-[1-naphthalen-2-yl-2-(prop-2-enoylamino)ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=CC(=O)NCC(NC(=O)c1coc(CC)n1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H21N3O3/c1-3-19(25)22-12-17(24-21(26)18-13-27-20(4-2)23-18)16-10-9-14-7-5-6-8-15(14)11-16/h3,5-11,13,17H,1,4,12H2,2H3,(H,22,25)(H,24,26) |
| InChIKey | LSCWYPLYHIRCNS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|