C12H12F3NO2 — CID 15487669
methyl (2S,3S)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate (PubChem CID 15487669) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is methyl (2S,3S)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate.
| Compound Name | methyl (2S,3S)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 15487669 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | methyl (2S,3S)-1-benzyl-3-(trifluoromethyl)aziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(F)(F)F)N1Cc1ccccc1 |
| InChI | InChI=1S/C12H12F3NO2/c1-18-11(17)9-10(12(13,14)15)16(9)7-8-5-3-2-4-6-8/h2-6,9-10H,7H2,1H3/t9-,10-,16?/m0/s1 |
| InChIKey | AAANRORVDXXJGX-VLVWQGGMSA-N |
| XLogP | 1.97 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|