C12H15F2NO3 — CID 154876819
methyl (E)-4-[(2,2-difluorospiro[2.3]hexane-5-carbonyl)amino]but-2-enoate (PubChem CID 154876819) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is methyl (E)-4-[(2,2-difluorospiro[2.3]hexane-5-carbonyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(2,2-difluorospiro[2.3]hexane-5-carbonyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 154876819 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | methyl (E)-4-[(2,2-difluorospiro[2.3]hexane-5-carbonyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C1CC2(C1)CC2(F)F |
| InChI | InChI=1S/C12H15F2NO3/c1-18-9(16)3-2-4-15-10(17)8-5-11(6-8)7-12(11,13)14/h2-3,8H,4-7H2,1H3,(H,15,17)/b3-2+ |
| InChIKey | LAMSFDGPKZSVTC-NSCUHMNNSA-N |
| XLogP | 1.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|