C11H16FNO3 — CID 167983507
methyl (E)-4-[(3-cyclopropyl-2-fluoropropanoyl)amino]but-2-enoate (PubChem CID 167983507) has the molecular formula C11H16FNO3 and a molecular weight of 229.25 g/mol. Its IUPAC name is methyl (E)-4-[(3-cyclopropyl-2-fluoropropanoyl)amino]but-2-enoate.
| Compound Name | methyl (E)-4-[(3-cyclopropyl-2-fluoropropanoyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 167983507 |
| Molecular Formula | C11H16FNO3 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl (E)-4-[(3-cyclopropyl-2-fluoropropanoyl)amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C(F)CC1CC1 |
| InChI | InChI=1S/C11H16FNO3/c1-16-10(14)3-2-6-13-11(15)9(12)7-8-4-5-8/h2-3,8-9H,4-7H2,1H3,(H,13,15)/b3-2+ |
| InChIKey | YFLNKCVPASVDBO-NSCUHMNNSA-N |
| XLogP | 0.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|