C13H15N5O3 — CID 154876875
methyl (E)-4-[[2-(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]but-2-enoate (PubChem CID 154876875) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is methyl (E)-4-[[2-(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[2-(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 154876875 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | methyl (E)-4-[[2-(6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)acetyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)Cc1nc2ncc(C)cn2n1 |
| InChI | InChI=1S/C13H15N5O3/c1-9-7-15-13-16-10(17-18(13)8-9)6-11(19)14-5-3-4-12(20)21-2/h3-4,7-8H,5-6H2,1-2H3,(H,14,19)/b4-3+ |
| InChIKey | DYRYEDMPPPFXFH-ONEGZZNKSA-N |
| XLogP | -0.18 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|