C17H13ClN4O3 — CID 154877144
2-[[2-(4-chlorophenyl)triazole-4-carbonyl]amino]-2-phenylacetic acid (PubChem CID 154877144) has the molecular formula C17H13ClN4O3 and a molecular weight of 356.77 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)triazole-4-carbonyl]amino]-2-phenylacetic acid.
| Compound Name | 2-[[2-(4-chlorophenyl)triazole-4-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 154877144 |
| Molecular Formula | C17H13ClN4O3 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)triazole-4-carbonyl]amino]-2-phenylacetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccccc1)c1cnn(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H13ClN4O3/c18-12-6-8-13(9-7-12)22-19-10-14(21-22)16(23)20-15(17(24)25)11-4-2-1-3-5-11/h1-10,15H,(H,20,23)(H,24,25) |
| InChIKey | LQAFMOQEDUSUGX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |