C19H22ClNO4S2 — CID 154878133
N-[3-(3-chlorophenyl)cyclopentyl]-2-methyl-5-methylsulfonylbenzenesulfonamide (PubChem CID 154878133) has the molecular formula C19H22ClNO4S2 and a molecular weight of 427.98 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)cyclopentyl]-2-methyl-5-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[3-(3-chlorophenyl)cyclopentyl]-2-methyl-5-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 154878133 |
| Molecular Formula | C19H22ClNO4S2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | N-[3-(3-chlorophenyl)cyclopentyl]-2-methyl-5-methylsulfonylbenzenesulfonamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1S(=O)(=O)NC1CCC(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H22ClNO4S2/c1-13-6-9-18(26(2,22)23)12-19(13)27(24,25)21-17-8-7-15(11-17)14-4-3-5-16(20)10-14/h3-6,9-10,12,15,17,21H,7-8,11H2,1-2H3 |
| InChIKey | COSGRYGHNWFZAH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |