About (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride
(1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride (PubChem CID 154878850) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride |
| PubChem CID | 154878850 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride |
| SMILES | CC1(C)OCc2cc(CN)ccc21.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-11(2)10-4-3-8(6-12)5-9(10)7-13-11;/h3-5H,6-7,12H2,1-2H3;1H |
| InChIKey | OUQXPXHSRUVQJI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride?
The IUPAC name of (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride (CID 154878850) is (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride.
What is the SMILES notation for (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride?
The canonical SMILES for (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride is CC1(C)OCc2cc(CN)ccc21.Cl.
What is the InChIKey of (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride?
The InChIKey is OUQXPXHSRUVQJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.ClH/c1-11(2)10-4-3-8(6-12)5-9(10)7-13-11;/h3-5H,6-7,12H2,1-2H3;1H.
What are the key properties of (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride?
(1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride has a molecular weight of 213.71 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dimethyl-3H-2-benzofuran-5-yl)methanamine;hydrochloride is sourced from PubChem (CID 154878850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).