C12H13F3N2O2S — CID 154880206
oxiran-2-yl-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone (PubChem CID 154880206) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is oxiran-2-yl-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | oxiran-2-yl-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 154880206 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | oxiran-2-yl-[4-[4-(trifluoromethyl)-1,3-thiazol-2-yl]piperidin-1-yl]methanone |
| SMILES | O=C(C1CO1)N1CCC(c2nc(C(F)(F)F)cs2)CC1 |
| InChI | InChI=1S/C12H13F3N2O2S/c13-12(14,15)9-6-20-10(16-9)7-1-3-17(4-2-7)11(18)8-5-19-8/h6-8H,1-5H2 |
| InChIKey | NWCDZUFAFOMISF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|