(5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid

C6H6BClO4S — CID 154881571

IUPAC(5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid
SMILESCOC(=O)c1sc(Cl)cc1B(O)O
InChIInChI=1S/C6H6BClO4S/c1-12-6(9)5-3(7(10)11)2-4(8)13-5/h2,10-11H,1H3
InChIKeyCWXRQHBUIRVDKJ-UHFFFAOYSA-N
MW220.44 g/mol
LogP-0.13
Rot. Bonds2

About (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid

(5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid (PubChem CID 154881571) has the molecular formula C6H6BClO4S and a molecular weight of 220.44 g/mol. Its IUPAC name is (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid.

Molecular Properties

Compound Name(5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid
PubChem CID154881571
Molecular FormulaC6H6BClO4S
Molecular Weight220.44 g/mol
Exact Mass219.98
IUPAC Name(5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid
SMILESCOC(=O)c1sc(Cl)cc1B(O)O
InChIInChI=1S/C6H6BClO4S/c1-12-6(9)5-3(7(10)11)2-4(8)13-5/h2,10-11H,1H3
InChIKeyCWXRQHBUIRVDKJ-UHFFFAOYSA-N
XLogP-0.13
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.44
LogP ≤ 5-0.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid?
The IUPAC name of (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid (CID 154881571) is (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid.
What is the SMILES notation for (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid?
The canonical SMILES for (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid is COC(=O)c1sc(Cl)cc1B(O)O.
What is the InChIKey of (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid?
The InChIKey is CWXRQHBUIRVDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BClO4S/c1-12-6(9)5-3(7(10)11)2-4(8)13-5/h2,10-11H,1H3.
What are the key properties of (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid?
(5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid has a molecular weight of 220.44 g/mol, XLogP of -0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-methoxycarbonylthiophen-3-yl)boronic acid is sourced from PubChem (CID 154881571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).