C10H12N6S — CID 154883389
3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,5-thiadiazole (PubChem CID 154883389) has the molecular formula C10H12N6S and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,5-thiadiazole.
| Compound Name | 3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 154883389 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-(4-pyrimidin-2-ylpiperazin-1-yl)-1,2,5-thiadiazole |
| SMILES | c1cnc(N2CCN(c3cnsn3)CC2)nc1 |
| InChI | InChI=1S/C10H12N6S/c1-2-11-10(12-3-1)16-6-4-15(5-7-16)9-8-13-17-14-9/h1-3,8H,4-7H2 |
| InChIKey | HTLODHZPTQRQPD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |