C18H22ClN3O2S — CID 154884108
8-(3-chloro-4-methylphenyl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane (PubChem CID 154884108) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 8-(3-chloro-4-methylphenyl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 8-(3-chloro-4-methylphenyl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 154884108 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 8-(3-chloro-4-methylphenyl)sulfonyl-3-(4-methylpyrazol-1-yl)-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1cnn(C2CC3CCC(C2)N3S(=O)(=O)c2ccc(C)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-12-10-20-21(11-12)16-7-14-4-5-15(8-16)22(14)25(23,24)17-6-3-13(2)18(19)9-17/h3,6,9-11,14-16H,4-5,7-8H2,1-2H3 |
| InChIKey | YHIRAVOSGBJJGP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |