C24H25N3O4 — CID 154884210
1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-[(4-methoxyphenyl)methyl]pyrazine-2,3-dione (PubChem CID 154884210) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-[(4-methoxyphenyl)methyl]pyrazine-2,3-dione.
| Compound Name | 1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-[(4-methoxyphenyl)methyl]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 154884210 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-[(4-methoxyphenyl)methyl]pyrazine-2,3-dione |
| SMILES | COc1ccc(Cn2ccn(CC3CC(=O)N(Cc4ccccc4)C3)c(=O)c2=O)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-31-21-9-7-19(8-10-21)14-25-11-12-26(24(30)23(25)29)16-20-13-22(28)27(17-20)15-18-5-3-2-4-6-18/h2-12,20H,13-17H2,1H3 |
| InChIKey | HHBBFMXONRDRIY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|