C23H25N3O4 — CID 167996807
1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-2,3-dione (PubChem CID 167996807) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-2,3-dione.
| Compound Name | 1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-2,3-dione |
|---|---|
| PubChem CID | 167996807 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[(1-benzyl-5-oxopyrrolidin-3-yl)methyl]-4-(3-methoxyphenyl)piperazine-2,3-dione |
| SMILES | COc1cccc(N2CCN(CC3CC(=O)N(Cc4ccccc4)C3)C(=O)C2=O)c1 |
| InChI | InChI=1S/C23H25N3O4/c1-30-20-9-5-8-19(13-20)26-11-10-24(22(28)23(26)29)15-18-12-21(27)25(16-18)14-17-6-3-2-4-7-17/h2-9,13,18H,10-12,14-16H2,1H3 |
| InChIKey | LXKKUZDIOIKJHW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|