C19H27F6N3O5S — CID 154885131
4-[4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butyl]morpholine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154885131) has the molecular formula C19H27F6N3O5S and a molecular weight of 523.50 g/mol. Its IUPAC name is 4-[4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butyl]morpholine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butyl]morpholine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154885131 |
| Molecular Formula | C19H27F6N3O5S |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 4-[4-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]butyl]morpholine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(C2CCCN2CCCCN2CCOCC2)n1 |
| InChI | InChI=1S/C15H25N3OS.2C2HF3O2/c1(6-17-9-11-19-12-10-17)2-7-18-8-3-4-14(18)15-16-5-13-20-15;2*3-2(4,5)1(6)7/h5,13-14H,1-4,6-12H2;2*(H,6,7) |
| InChIKey | GDOVUTVQBSHJBS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|