C19H25F6N3O6S — CID 155841028
(4aR,7aS)-4-(oxolan-2-ylmethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155841028) has the molecular formula C19H25F6N3O6S and a molecular weight of 537.48 g/mol. Its IUPAC name is (4aR,7aS)-4-(oxolan-2-ylmethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aR,7aS)-4-(oxolan-2-ylmethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155841028 |
| Molecular Formula | C19H25F6N3O6S |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (4aR,7aS)-4-(oxolan-2-ylmethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CN2C[C@@H]3OCCN(CC4CCCO4)[C@@H]3C2)n1 |
| InChI | InChI=1S/C15H23N3O2S.2C2HF3O2/c1-2-12(19-5-1)8-18-4-6-20-14-10-17(9-13(14)18)11-15-16-3-7-21-15;2*3-2(4,5)1(6)7/h3,7,12-14H,1-2,4-6,8-11H2;2*(H,6,7)/t12?,13-,14+;;/m1../s1 |
| InChIKey | USXIVVHSKNQPFQ-DWMQUUDTSA-N |
| XLogP | 2.47 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |