C20H27F6N3O5S — CID 155823830
(3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155823830) has the molecular formula C20H27F6N3O5S and a molecular weight of 535.51 g/mol. Its IUPAC name is (3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155823830 |
| Molecular Formula | C20H27F6N3O5S |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | (3S,3aR,7aR)-3-(pyrrolidin-1-ylmethyl)-5-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CN2CC[C@H]3CO[C@H](CN4CCCC4)[C@H]3C2)n1 |
| InChI | InChI=1S/C16H25N3OS.2C2HF3O2/c1-2-6-18(5-1)10-15-14-9-19(7-3-13(14)12-20-15)11-16-17-4-8-21-16;2*3-2(4,5)1(6)7/h4,8,13-15H,1-3,5-7,9-12H2;2*(H,6,7)/t13-,14-,15+;;/m0../s1 |
| InChIKey | NDESWYKSOHDPIT-DPJDSMRSSA-N |
| XLogP | 3.34 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |