C17H24F3N3O4S — CID 155825014
2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155825014) has the molecular formula C17H24F3N3O4S and a molecular weight of 423.46 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825014 |
| Molecular Formula | C17H24F3N3O4S |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-(1,3-thiazol-2-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)C[C@@H]1COC[C@H]2CN(Cc3nccs3)C[C@@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O2S.C2HF3O2/c1-17(2)15(19)5-11-9-20-10-12-6-18(7-13(11)12)8-14-16-3-4-21-14;3-2(4,5)1(6)7/h3-4,11-13H,5-10H2,1-2H3;(H,6,7)/t11-,12-,13+;/m1./s1 |
| InChIKey | KVNUWEPWWVWELQ-GMSSCWEGSA-N |
| XLogP | 1.95 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |