C18H23F6N3O5S — CID 155829493
2-[(7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155829493) has the molecular formula C18H23F6N3O5S and a molecular weight of 507.45 g/mol. Its IUPAC name is 2-[(7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155829493 |
| Molecular Formula | C18H23F6N3O5S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-[(7-prop-2-enoxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCOC1CC2CN(Cc3nccs3)CCN2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3OS.2C2HF3O2/c1-2-6-18-13-8-12-9-16(4-5-17(12)10-13)11-14-15-3-7-19-14;2*3-2(4,5)1(6)7/h2-3,7,12-13H,1,4-6,8-11H2;2*(H,6,7) |
| InChIKey | OSEADXKLQXCHKE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|