C15H21F3N2O4S — CID 155842804
(3aS,7R,7aS)-7-ethoxy-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155842804) has the molecular formula C15H21F3N2O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is (3aS,7R,7aS)-7-ethoxy-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,7R,7aS)-7-ethoxy-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842804 |
| Molecular Formula | C15H21F3N2O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (3aS,7R,7aS)-7-ethoxy-4-(1,3-thiazol-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | CCO[C@@H]1CCN(Cc2nccs2)[C@H]2CCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N2O2S.C2HF3O2/c1-2-16-11-3-6-15(9-12-14-5-8-18-12)10-4-7-17-13(10)11;3-2(4,5)1(6)7/h5,8,10-11,13H,2-4,6-7,9H2,1H3;(H,6,7)/t10-,11+,13-;/m0./s1 |
| InChIKey | GJLVDRSRXMFXJJ-LWEGJDAASA-N |
| XLogP | 2.54 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |