C19H18ClN5O2S — CID 154885551
4-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;hydrochloride (PubChem CID 154885551) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is 4-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;hydrochloride.
| Compound Name | 4-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;hydrochloride |
|---|---|
| PubChem CID | 154885551 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one;hydrochloride |
| SMILES | Cc1cccc(-c2noc(Cn3cnc4sc5c(c4c3=O)CCNC5)n2)c1.Cl |
| InChI | InChI=1S/C19H17N5O2S.ClH/c1-11-3-2-4-12(7-11)17-22-15(26-23-17)9-24-10-21-18-16(19(24)25)13-5-6-20-8-14(13)27-18;/h2-4,7,10,20H,5-6,8-9H2,1H3;1H |
| InChIKey | GEEUXHCWAPMXNO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |