C17H15N5OS — CID 70758824
4-(imidazo[1,2-a]pyridin-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 70758824) has the molecular formula C17H15N5OS and a molecular weight of 337.41 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridin-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-(imidazo[1,2-a]pyridin-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 70758824 |
| Molecular Formula | C17H15N5OS |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-(imidazo[1,2-a]pyridin-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1c2c3c(sc2ncn1Cc1cn2ccccc2n1)CNCC3 |
| InChI | InChI=1S/C17H15N5OS/c23-17-15-12-4-5-18-7-13(12)24-16(15)19-10-22(17)9-11-8-21-6-2-1-3-14(21)20-11/h1-3,6,8,10,18H,4-5,7,9H2 |
| InChIKey | RPUXZSQQNCPTGR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |